C22H34N2O10 — CID 138733254
[(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-butylpiperazine-1-carbonyl)oxan-4-yl] acetate (PubChem CID 138733254) has the molecular formula C22H34N2O10 and a molecular weight of 486.52 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-butylpiperazine-1-carbonyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-butylpiperazine-1-carbonyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 138733254 |
| Molecular Formula | C22H34N2O10 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-butylpiperazine-1-carbonyl)oxan-4-yl] acetate |
| SMILES | CCCCN1CCN(C(=O)[C@H]2O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)CC1 |
| InChI | InChI=1S/C22H34N2O10/c1-6-7-8-23-9-11-24(12-10-23)21(29)19-17(30-13(2)25)18(31-14(3)26)20(32-15(4)27)22(34-19)33-16(5)28/h17-20,22H,6-12H2,1-5H3/t17-,18-,19-,20+,22+/m0/s1 |
| InChIKey | RSFNOILYOPXONK-YIUJWAEMSA-N |
| XLogP | 0.01 |
| TPSA | 137.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|