C15H16FNO4 — CID 138733863
(4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 138733863) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138733863 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O)[C@@](C)(F)C(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16FNO4/c1-3-12(18)15(2,16)13(19)17-11(9-21-14(17)20)10-7-5-4-6-8-10/h3-8,11-12,18H,1,9H2,2H3/t11-,12+,15+/m0/s1 |
| InChIKey | KANHFRGLHAXYIP-YWPYICTPSA-N |
| XLogP | 1.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|