C28H32F3N — CID 138734442
(3Z,5E)-N-ethenyl-2,5-dimethyl-3-[2-(4-methylphenyl)ethyl]-6-[3-(2,2,2-trifluoroethyl)phenyl]hepta-1,3,5-trien-4-amine (PubChem CID 138734442) has the molecular formula C28H32F3N and a molecular weight of 439.57 g/mol. Its IUPAC name is (3Z,5E)-N-ethenyl-2,5-dimethyl-3-[2-(4-methylphenyl)ethyl]-6-[3-(2,2,2-trifluoroethyl)phenyl]hepta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5E)-N-ethenyl-2,5-dimethyl-3-[2-(4-methylphenyl)ethyl]-6-[3-(2,2,2-trifluoroethyl)phenyl]hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 138734442 |
| Molecular Formula | C28H32F3N |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (3Z,5E)-N-ethenyl-2,5-dimethyl-3-[2-(4-methylphenyl)ethyl]-6-[3-(2,2,2-trifluoroethyl)phenyl]hepta-1,3,5-trien-4-amine |
| SMILES | C=CNC(=C(/CCc1ccc(C)cc1)C(=C)C)/C(C)=C(\C)c1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F3N/c1-7-32-27(26(19(2)3)16-15-23-13-11-20(4)12-14-23)22(6)21(5)25-10-8-9-24(17-25)18-28(29,30)31/h7-14,17,32H,1-2,15-16,18H2,3-6H3/b22-21+,27-26- |
| InChIKey | HKSLYNSCTCNROP-RYXHEWMCSA-N |
| XLogP | 8.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|