C23H24F3N5O4 — CID 138734846
3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2,2,2-trifluoroethylamino)pyrazole-4-carboxamide (PubChem CID 138734846) has the molecular formula C23H24F3N5O4 and a molecular weight of 491.47 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2,2,2-trifluoroethylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2,2,2-trifluoroethylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138734846 |
| Molecular Formula | C23H24F3N5O4 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2,2,2-trifluoroethylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](n2nc(C#Cc3cc(OC)cc(OC)c3)c(C(N)=O)c2NCC(F)(F)F)C1 |
| InChI | InChI=1S/C23H24F3N5O4/c1-4-19(32)30-8-7-15(12-30)31-22(28-13-23(24,25)26)20(21(27)33)18(29-31)6-5-14-9-16(34-2)11-17(10-14)35-3/h4,9-11,15,28H,1,7-8,12-13H2,2-3H3,(H2,27,33)/t15-/m0/s1 |
| InChIKey | JXSFGLJKCOYKCU-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|