C14H20BrN5O2 — CID 138734910
tert-butyl 3-[3-bromo-4-cyano-5-(methylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 138734910) has the molecular formula C14H20BrN5O2 and a molecular weight of 370.25 g/mol. Its IUPAC name is tert-butyl 3-[3-bromo-4-cyano-5-(methylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-bromo-4-cyano-5-(methylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138734910 |
| Molecular Formula | C14H20BrN5O2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | tert-butyl 3-[3-bromo-4-cyano-5-(methylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CNc1c(C#N)c(Br)nn1C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H20BrN5O2/c1-14(2,3)22-13(21)19-6-5-9(8-19)20-12(17-4)10(7-16)11(15)18-20/h9,17H,5-6,8H2,1-4H3 |
| InChIKey | CSLSZQAXTBKEEF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |