C14H20N2O — CID 138735346
1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,7-benzodiazecin-8-one (PubChem CID 138735346) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,7-benzodiazecin-8-one.
| Compound Name | 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,7-benzodiazecin-8-one |
|---|---|
| PubChem CID | 138735346 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,7-benzodiazecin-8-one |
| SMILES | CC1CCNC(=O)c2ccccc2N(C)CC1 |
| InChI | InChI=1S/C14H20N2O/c1-11-7-9-15-14(17)12-5-3-4-6-13(12)16(2)10-8-11/h3-6,11H,7-10H2,1-2H3,(H,15,17) |
| InChIKey | SNLMXTMWGNGZBT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |