About N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine
N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine (PubChem CID 138736623) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine.
Molecular Properties
| Compound Name | N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine |
| PubChem CID | 138736623 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine |
| SMILES | C=C(CCC(C)(C)C)NCNC(=C)CC(C)(C)C |
| InChI | InChI=1S/C16H32N2/c1-13(9-10-15(3,4)5)17-12-18-14(2)11-16(6,7)8/h17-18H,1-2,9-12H2,3-8H3 |
| InChIKey | RJOCZHIPGUWUDG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine?
The IUPAC name of N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine (CID 138736623) is N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine.
What is the SMILES notation for N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine?
The canonical SMILES for N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine is C=C(CCC(C)(C)C)NCNC(=C)CC(C)(C)C.
What is the InChIKey of N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine?
The InChIKey is RJOCZHIPGUWUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-13(9-10-15(3,4)5)17-12-18-14(2)11-16(6,7)8/h17-18H,1-2,9-12H2,3-8H3.
What are the key properties of N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine?
N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine has a molecular weight of 252.45 g/mol, XLogP of 4.41, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dimethylhex-1-en-2-yl)-N'-(4,4-dimethylpent-1-en-2-yl)methanediamine is sourced from PubChem (CID 138736623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).