C16H24N2 — CID 138737532
N'-[1-[(6R)-2,6-dimethylcyclohepta-2,4-dien-1-yl]ethenyl]-N,N-dimethylprop-2-enimidamide (PubChem CID 138737532) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N'-[1-[(6R)-2,6-dimethylcyclohepta-2,4-dien-1-yl]ethenyl]-N,N-dimethylprop-2-enimidamide.
| Compound Name | N'-[1-[(6R)-2,6-dimethylcyclohepta-2,4-dien-1-yl]ethenyl]-N,N-dimethylprop-2-enimidamide |
|---|---|
| PubChem CID | 138737532 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N'-[1-[(6R)-2,6-dimethylcyclohepta-2,4-dien-1-yl]ethenyl]-N,N-dimethylprop-2-enimidamide |
| SMILES | C=C/C(=N\C(=C)C1C[C@@H](C)C=CC=C1C)N(C)C |
| InChI | InChI=1S/C16H24N2/c1-7-16(18(5)6)17-14(4)15-11-12(2)9-8-10-13(15)3/h7-10,12,15H,1,4,11H2,2-3,5-6H3/b17-16+/t12-,15?/m0/s1 |
| InChIKey | CVVGQMZYAZGQPB-OJOHQSHESA-N |
| XLogP | 3.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|