About 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide
2-imino-N'-[(Z)-prop-1-enyl]propanimidamide (PubChem CID 138737588) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide.
Molecular Properties
| Compound Name | 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide |
| PubChem CID | 138737588 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide |
| SMILES | [H]/N=C(C)/C(N)=N/C=C\C |
| InChI | InChI=1S/C6H11N3/c1-3-4-9-6(8)5(2)7/h3-4,7H,1-2H3,(H2,8,9)/b4-3-,7-5+ |
| InChIKey | VBGFCASUUHWLOV-QVXLNCAUSA-N |
| XLogP | 0.92 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide?
The IUPAC name of 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide (CID 138737588) is 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide.
What is the SMILES notation for 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide?
The canonical SMILES for 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide is [H]/N=C(C)/C(N)=N/C=C\C.
What is the InChIKey of 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide?
The InChIKey is VBGFCASUUHWLOV-QVXLNCAUSA-N. The full InChI is InChI=1S/C6H11N3/c1-3-4-9-6(8)5(2)7/h3-4,7H,1-2H3,(H2,8,9)/b4-3-,7-5+.
What are the key properties of 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide?
2-imino-N'-[(Z)-prop-1-enyl]propanimidamide has a molecular weight of 125.17 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-N'-[(Z)-prop-1-enyl]propanimidamide is sourced from PubChem (CID 138737588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).