C24H38N2O14 — CID 138737673
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 138737673) has the molecular formula C24H38N2O14 and a molecular weight of 578.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 138737673 |
| Molecular Formula | C24H38N2O14 |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CCOCCOCCOCCOCCOCCOCCC(O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H38N2O14/c27-19-1-2-20(28)25(19)39-23(31)5-7-33-9-11-35-13-15-37-17-18-38-16-14-36-12-10-34-8-6-24(32)40-26-21(29)3-4-22(26)30/h23,31H,1-18H2 |
| InChIKey | YLMMZKSCGFEBOS-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 185.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|