C13H11BrFN5O4 — CID 138737763
3-[4-(3-aminopropoxy)-1,2,5-oxadiazol-3-yl]-4-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-one (PubChem CID 138737763) has the molecular formula C13H11BrFN5O4 and a molecular weight of 400.16 g/mol. Its IUPAC name is 3-[4-(3-aminopropoxy)-1,2,5-oxadiazol-3-yl]-4-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-(3-aminopropoxy)-1,2,5-oxadiazol-3-yl]-4-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 138737763 |
| Molecular Formula | C13H11BrFN5O4 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 3-[4-(3-aminopropoxy)-1,2,5-oxadiazol-3-yl]-4-(3-bromo-4-fluorophenyl)-1,2,4-oxadiazol-5-one |
| SMILES | NCCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H11BrFN5O4/c14-8-6-7(2-3-9(8)15)20-11(18-23-13(20)21)10-12(19-24-17-10)22-5-1-4-16/h2-3,6H,1,4-5,16H2 |
| InChIKey | VWQJPQRRKDYTEL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|