C11H12F2N6O5S — CID 138737770
N'-(3,4-difluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138737770) has the molecular formula C11H12F2N6O5S and a molecular weight of 378.32 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3,4-difluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138737770 |
| Molecular Formula | C11H12F2N6O5S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N'-(3,4-difluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCOc1nonc1/C(=N/c1ccc(F)c(F)c1)NO |
| InChI | InChI=1S/C11H12F2N6O5S/c12-7-2-1-6(5-8(7)13)16-10(17-20)9-11(19-24-18-9)23-4-3-15-25(14,21)22/h1-2,5,15,20H,3-4H2,(H,16,17)(H2,14,21,22) |
| InChIKey | OPWBJWWRBAHZFW-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|