C14H17FN6O5S — CID 138737774
N'-(3-cyclopropyl-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138737774) has the molecular formula C14H17FN6O5S and a molecular weight of 400.39 g/mol. Its IUPAC name is N'-(3-cyclopropyl-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-cyclopropyl-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138737774 |
| Molecular Formula | C14H17FN6O5S |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N'-(3-cyclopropyl-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCOc1nonc1/C(=N/c1ccc(F)c(C2CC2)c1)NO |
| InChI | InChI=1S/C14H17FN6O5S/c15-11-4-3-9(7-10(11)8-1-2-8)18-13(19-22)12-14(21-26-20-12)25-6-5-17-27(16,23)24/h3-4,7-8,17,22H,1-2,5-6H2,(H,18,19)(H2,16,23,24) |
| InChIKey | VYKBIRBQDRQAIO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|