C15H16BrFN6O4 — CID 138737878
1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-prop-2-enylurea (PubChem CID 138737878) has the molecular formula C15H16BrFN6O4 and a molecular weight of 443.23 g/mol. Its IUPAC name is 1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-prop-2-enylurea.
| Compound Name | 1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 138737878 |
| Molecular Formula | C15H16BrFN6O4 |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 1-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NCCOc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H16BrFN6O4/c1-2-5-18-15(24)19-6-7-26-14-12(22-27-23-14)13(21-25)20-9-3-4-11(17)10(16)8-9/h2-4,8,25H,1,5-7H2,(H,20,21)(H2,18,19,24) |
| InChIKey | JRDMMHDUSBOLHL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|