C23H21ClFIN6O2 — CID 138737968
[5-chloro-2-(triazol-1-yl)phenyl]-[1-[(5-fluoro-2-pyridinyl)oxymethyl]-3-(2-iodoethyl)-4-methanimidoyl-2-azabicyclo[2.2.0]hexan-2-yl]methanone (PubChem CID 138737968) has the molecular formula C23H21ClFIN6O2 and a molecular weight of 594.82 g/mol. Its IUPAC name is [5-chloro-2-(triazol-1-yl)phenyl]-[1-[(5-fluoro-2-pyridinyl)oxymethyl]-3-(2-iodoethyl)-4-methanimidoyl-2-azabicyclo[2.2.0]hexan-2-yl]methanone.
| Compound Name | [5-chloro-2-(triazol-1-yl)phenyl]-[1-[(5-fluoro-2-pyridinyl)oxymethyl]-3-(2-iodoethyl)-4-methanimidoyl-2-azabicyclo[2.2.0]hexan-2-yl]methanone |
|---|---|
| PubChem CID | 138737968 |
| Molecular Formula | C23H21ClFIN6O2 |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | [5-chloro-2-(triazol-1-yl)phenyl]-[1-[(5-fluoro-2-pyridinyl)oxymethyl]-3-(2-iodoethyl)-4-methanimidoyl-2-azabicyclo[2.2.0]hexan-2-yl]methanone |
| SMILES | [H]/N=C/C12CCC1(COc1ccc(F)cn1)N(C(=O)c1cc(Cl)ccc1-n1ccnn1)C2CCI |
| InChI | InChI=1S/C23H21ClFIN6O2/c24-15-1-3-18(31-10-9-29-30-31)17(11-15)21(33)32-19(5-8-26)22(13-27)6-7-23(22,32)14-34-20-4-2-16(25)12-28-20/h1-4,9-13,19,27H,5-8,14H2/b27-13+ |
| InChIKey | UPGGCYHWCWEYIW-UVHMKAGCSA-N |
| XLogP | 4.35 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|