C12H13F3N6O5S — CID 138738325
N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 138738325) has the molecular formula C12H13F3N6O5S and a molecular weight of 410.33 g/mol. Its IUPAC name is N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 138738325 |
| Molecular Formula | C12H13F3N6O5S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCOc1nonc1/C(=N/c1ccc(F)c(C(F)F)c1)NO |
| InChI | InChI=1S/C12H13F3N6O5S/c13-8-2-1-6(5-7(8)10(14)15)18-11(19-22)9-12(21-26-20-9)25-4-3-17-27(16,23)24/h1-2,5,10,17,22H,3-4H2,(H,18,19)(H2,16,23,24) |
| InChIKey | BKKVGFDVJGTJIZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|