C12H18OS — CID 138738701
(3Z,5Z)-3-ethenyl-6-(2-sulfanylethyl)octa-3,5,7-trien-1-ol (PubChem CID 138738701) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (3Z,5Z)-3-ethenyl-6-(2-sulfanylethyl)octa-3,5,7-trien-1-ol.
| Compound Name | (3Z,5Z)-3-ethenyl-6-(2-sulfanylethyl)octa-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 138738701 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3Z,5Z)-3-ethenyl-6-(2-sulfanylethyl)octa-3,5,7-trien-1-ol |
| SMILES | C=C/C(=C\C=C(/C=C)CCS)CCO |
| InChI | InChI=1S/C12H18OS/c1-3-11(7-9-13)5-6-12(4-2)8-10-14/h3-6,13-14H,1-2,7-10H2/b11-5+,12-6+ |
| InChIKey | CHRRXJGPSMKMOO-YDWXAUTNSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|