C16H29NO2 — CID 138738998
(3E,5E)-3,5-dibutoxyocta-3,5,7-trien-2-amine (PubChem CID 138738998) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (3E,5E)-3,5-dibutoxyocta-3,5,7-trien-2-amine.
| Compound Name | (3E,5E)-3,5-dibutoxyocta-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 138738998 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (3E,5E)-3,5-dibutoxyocta-3,5,7-trien-2-amine |
| SMILES | C=C/C=C(\C=C(\OCCCC)C(C)N)OCCCC |
| InChI | InChI=1S/C16H29NO2/c1-5-8-11-18-15(10-7-3)13-16(14(4)17)19-12-9-6-2/h7,10,13-14H,3,5-6,8-9,11-12,17H2,1-2,4H3/b15-10+,16-13+ |
| InChIKey | QLEJHURVKRUIIJ-XGJXTRRESA-N |
| XLogP | 3.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|