About (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite
(3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite (PubChem CID 138739365) has the molecular formula C19H14F3O3P
and a molecular weight of 378.29 g/mol. Its IUPAC name is (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite |
| PubChem CID | 138739365 |
| Molecular Formula | C19H14F3O3P |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite |
| SMILES | Cc1ccc(OP(Oc2ccccc2)Oc2ccc(F)c(F)c2)cc1F |
| InChI | InChI=1S/C19H14F3O3P/c1-13-7-8-15(11-18(13)21)24-26(23-14-5-3-2-4-6-14)25-16-9-10-17(20)19(22)12-16/h2-12H,1H3 |
| InChIKey | PTOAZSARESIVTI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite?
The IUPAC name of (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite (CID 138739365) is (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite.
What is the SMILES notation for (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite?
The canonical SMILES for (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite is Cc1ccc(OP(Oc2ccccc2)Oc2ccc(F)c(F)c2)cc1F.
What is the InChIKey of (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite?
The InChIKey is PTOAZSARESIVTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3O3P/c1-13-7-8-15(11-18(13)21)24-26(23-14-5-3-2-4-6-14)25-16-9-10-17(20)19(22)12-16/h2-12H,1H3.
What are the key properties of (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite?
(3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite has a molecular weight of 378.29 g/mol, XLogP of 6.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) (3-fluoro-4-methylphenyl) phenyl phosphite is sourced from PubChem (CID 138739365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).