C32H38N4 — CID 138739496
3,7-bis(cyclohexylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 138739496) has the molecular formula C32H38N4 and a molecular weight of 478.68 g/mol. Its IUPAC name is 3,7-bis(cyclohexylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine.
| Compound Name | 3,7-bis(cyclohexylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 138739496 |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 3,7-bis(cyclohexylmethyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(CC3CCCCC3)c2ncn1CC1CCCCC1 |
| InChI | InChI=1S/C32H38N4/c33-31-29-28(26-17-9-3-10-18-26)30(27-19-11-4-12-20-27)36(22-25-15-7-2-8-16-25)32(29)34-23-35(31)21-24-13-5-1-6-14-24/h3-4,9-12,17-20,23-25,33H,1-2,5-8,13-16,21-22H2/b33-31- |
| InChIKey | KQZJNJISHHTSKK-FPODKLOTSA-N |
| XLogP | 7.81 |
| TPSA | 46.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |