C33H34N4O2 — CID 138739569
7-benzyl-3-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 138739569) has the molecular formula C33H34N4O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 7-benzyl-3-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-imine.
| Compound Name | 7-benzyl-3-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 138739569 |
| Molecular Formula | C33H34N4O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 7-benzyl-3-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c2c(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)n(Cc3ccccc3)c2ncn1C1CCCCC1 |
| InChI | InChI=1S/C33H34N4O2/c1-38-27-17-13-24(14-18-27)29-30-32(34)37(26-11-7-4-8-12-26)22-35-33(30)36(21-23-9-5-3-6-10-23)31(29)25-15-19-28(39-2)20-16-25/h3,5-6,9-10,13-20,22,26,34H,4,7-8,11-12,21H2,1-2H3/b34-32- |
| InChIKey | LRKDHNSGVZRSIT-YJKCNMNRSA-N |
| XLogP | 7.22 |
| TPSA | 65.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |