C10H18IN — CID 138739781
(3S,4S)-1-(cyclopropylmethyl)-3-iodo-4-methylpiperidine (PubChem CID 138739781) has the molecular formula C10H18IN and a molecular weight of 279.17 g/mol. Its IUPAC name is (3S,4S)-1-(cyclopropylmethyl)-3-iodo-4-methylpiperidine.
| Compound Name | (3S,4S)-1-(cyclopropylmethyl)-3-iodo-4-methylpiperidine |
|---|---|
| PubChem CID | 138739781 |
| Molecular Formula | C10H18IN |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (3S,4S)-1-(cyclopropylmethyl)-3-iodo-4-methylpiperidine |
| SMILES | C[C@H]1CCN(CC2CC2)C[C@H]1I |
| InChI | InChI=1S/C10H18IN/c1-8-4-5-12(7-10(8)11)6-9-2-3-9/h8-10H,2-7H2,1H3/t8-,10+/m0/s1 |
| InChIKey | PLHIVGLKDHIFCK-WCBMZHEXSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|