About 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine
6-chloro-5,6-dihydropyrido[2,3-b]pyrazine (PubChem CID 138740060) has the molecular formula C7H6ClN3
and a molecular weight of 167.60 g/mol. Its IUPAC name is 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine |
| PubChem CID | 138740060 |
| Molecular Formula | C7H6ClN3 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine |
| SMILES | ClC1C=Cc2nccnc2N1 |
| InChI | InChI=1S/C7H6ClN3/c8-6-2-1-5-7(11-6)10-4-3-9-5/h1-4,6H,(H,10,11) |
| InChIKey | QWGOUEZVWBZEBV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine?
The IUPAC name of 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine (CID 138740060) is 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine.
What is the SMILES notation for 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine?
The canonical SMILES for 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine is ClC1C=Cc2nccnc2N1.
What is the InChIKey of 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine?
The InChIKey is QWGOUEZVWBZEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3/c8-6-2-1-5-7(11-6)10-4-3-9-5/h1-4,6H,(H,10,11).
What are the key properties of 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine?
6-chloro-5,6-dihydropyrido[2,3-b]pyrazine has a molecular weight of 167.60 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5,6-dihydropyrido[2,3-b]pyrazine is sourced from PubChem (CID 138740060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).