C23H24ClN3O — CID 138740253
[(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(1H-indol-4-yl)methanone (PubChem CID 138740253) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(1H-indol-4-yl)methanone.
| Compound Name | [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(1H-indol-4-yl)methanone |
|---|---|
| PubChem CID | 138740253 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [(7R,9aR)-7-(4-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(1H-indol-4-yl)methanone |
| SMILES | O=C(c1cccc2[nH]ccc12)N1CCN2C[C@@H](c3ccc(Cl)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C23H24ClN3O/c24-18-7-4-16(5-8-18)17-6-9-19-15-27(13-12-26(19)14-17)23(28)21-2-1-3-22-20(21)10-11-25-22/h1-5,7-8,10-11,17,19,25H,6,9,12-15H2/t17-,19+/m0/s1 |
| InChIKey | FHDJASBIJHEEGM-PKOBYXMFSA-N |
| XLogP | 4.53 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |