C13H12N2O3 — CID 138740494
3-[2-(1-methylindol-3-yl)ethyl]-1,4,2-dioxazol-5-one (PubChem CID 138740494) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[2-(1-methylindol-3-yl)ethyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[2-(1-methylindol-3-yl)ethyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 138740494 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[2-(1-methylindol-3-yl)ethyl]-1,4,2-dioxazol-5-one |
| SMILES | Cn1cc(CCc2noc(=O)o2)c2ccccc21 |
| InChI | InChI=1S/C13H12N2O3/c1-15-8-9(10-4-2-3-5-11(10)15)6-7-12-14-18-13(16)17-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | SVKWSDNAILVEHR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |