About 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine (PubChem CID 138740633) has the molecular formula C11H12N6O
and a molecular weight of 244.26 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine |
| PubChem CID | 138740633 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(C)noc2C)c2nc[nH]c12 |
| InChI | InChI=1S/C11H12N6O/c1-6-8(7(2)18-16-6)3-17-5-15-10(12)9-11(17)14-4-13-9/h4-5,12H,3H2,1-2H3,(H,13,14)/b12-10- |
| InChIKey | UHRROTQRFBDHCU-BENRWUELSA-N |
| XLogP | 0.89 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine?
The IUPAC name of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine (CID 138740633) is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine.
What is the SMILES notation for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine?
The canonical SMILES for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine is [H]/N=c1\ncn(Cc2c(C)noc2C)c2nc[nH]c12.
What is the InChIKey of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine?
The InChIKey is UHRROTQRFBDHCU-BENRWUELSA-N. The full InChI is InChI=1S/C11H12N6O/c1-6-8(7(2)18-16-6)3-17-5-15-10(12)9-11(17)14-4-13-9/h4-5,12H,3H2,1-2H3,(H,13,14)/b12-10-.
What are the key properties of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine?
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine has a molecular weight of 244.26 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7H-purin-6-imine is sourced from PubChem (CID 138740633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).