C19H22N3O5P — CID 138741061
2-[4-(methylaminomethyl)phenyl]-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one;phosphoric acid (PubChem CID 138741061) has the molecular formula C19H22N3O5P and a molecular weight of 403.38 g/mol. Its IUPAC name is 2-[4-(methylaminomethyl)phenyl]-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one;phosphoric acid.
| Compound Name | 2-[4-(methylaminomethyl)phenyl]-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one;phosphoric acid |
|---|---|
| PubChem CID | 138741061 |
| Molecular Formula | C19H22N3O5P |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[4-(methylaminomethyl)phenyl]-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one;phosphoric acid |
| SMILES | CNCc1ccc(-c2[nH]c3cccc4c3c2CCNC4=O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C19H19N3O.H3O4P/c1-20-11-12-5-7-13(8-6-12)18-14-9-10-21-19(23)15-3-2-4-16(22-18)17(14)15;1-5(2,3)4/h2-8,20,22H,9-11H2,1H3,(H,21,23);(H3,1,2,3,4) |
| InChIKey | JQKMLSNLCLOHBK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|