About 5-aminocyclohepta-1,4,6-trien-1-ol
5-aminocyclohepta-1,4,6-trien-1-ol (PubChem CID 138741221) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 5-aminocyclohepta-1,4,6-trien-1-ol.
Molecular Properties
| Compound Name | 5-aminocyclohepta-1,4,6-trien-1-ol |
| PubChem CID | 138741221 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 5-aminocyclohepta-1,4,6-trien-1-ol |
| SMILES | NC1=CCC=C(O)C=C1 |
| InChI | InChI=1S/C7H9NO/c8-6-2-1-3-7(9)5-4-6/h2-5,9H,1,8H2 |
| InChIKey | POQGCEKREKOGDV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-aminocyclohepta-1,4,6-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminocyclohepta-1,4,6-trien-1-ol?
The IUPAC name of 5-aminocyclohepta-1,4,6-trien-1-ol (CID 138741221) is 5-aminocyclohepta-1,4,6-trien-1-ol.
What is the SMILES notation for 5-aminocyclohepta-1,4,6-trien-1-ol?
The canonical SMILES for 5-aminocyclohepta-1,4,6-trien-1-ol is NC1=CCC=C(O)C=C1.
What is the InChIKey of 5-aminocyclohepta-1,4,6-trien-1-ol?
The InChIKey is POQGCEKREKOGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c8-6-2-1-3-7(9)5-4-6/h2-5,9H,1,8H2.
What are the key properties of 5-aminocyclohepta-1,4,6-trien-1-ol?
5-aminocyclohepta-1,4,6-trien-1-ol has a molecular weight of 123.15 g/mol, XLogP of 1.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminocyclohepta-1,4,6-trien-1-ol is sourced from PubChem (CID 138741221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).