C13H8F12O6 — CID 138741623
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)propanedioate (PubChem CID 138741623) has the molecular formula C13H8F12O6 and a molecular weight of 488.18 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)propanedioate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)propanedioate |
|---|---|
| PubChem CID | 138741623 |
| Molecular Formula | C13H8F12O6 |
| Molecular Weight | 488.18 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-(2-methylprop-2-enoyloxy)propanedioate |
| SMILES | C=C(C)C(=O)OC(C(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F12O6/c1-3(2)5(26)29-4(6(27)30-8(10(14,15)16)11(17,18)19)7(28)31-9(12(20,21)22)13(23,24)25/h4,8-9H,1H2,2H3 |
| InChIKey | LTYXGXFHMGSEGV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|