About 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine
7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine (PubChem CID 138741814) has the molecular formula C10H5ClINOS
and a molecular weight of 349.58 g/mol. Its IUPAC name is 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine.
Molecular Properties
| Compound Name | 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine |
| PubChem CID | 138741814 |
| Molecular Formula | C10H5ClINOS |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 348.88 |
| IUPAC Name | 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine |
| SMILES | Clc1ccc2c3c(sc2c1)C(I)=NOC3 |
| InChI | InChI=1S/C10H5ClINOS/c11-5-1-2-6-7-4-14-13-10(12)9(7)15-8(6)3-5/h1-3H,4H2 |
| InChIKey | JHNPSGFVMWWLJU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine?
The IUPAC name of 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine (CID 138741814) is 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine.
What is the SMILES notation for 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine?
The canonical SMILES for 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine is Clc1ccc2c3c(sc2c1)C(I)=NOC3.
What is the InChIKey of 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine?
The InChIKey is JHNPSGFVMWWLJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClINOS/c11-5-1-2-6-7-4-14-13-10(12)9(7)15-8(6)3-5/h1-3H,4H2.
What are the key properties of 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine?
7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine has a molecular weight of 349.58 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-iodo-1H-[1]benzothiolo[2,3-d]oxazine is sourced from PubChem (CID 138741814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).