About (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene
(E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene (PubChem CID 138741990) has the molecular formula C12H21F3O
and a molecular weight of 238.29 g/mol. Its IUPAC name is (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene.
Molecular Properties
| Compound Name | (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene |
| PubChem CID | 138741990 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene |
| SMILES | C/C=C(\CCCCC)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H21F3O/c1-3-5-6-7-11(4-2)8-9-16-10-12(13,14)15/h4H,3,5-10H2,1-2H3/b11-4+ |
| InChIKey | AATAVTUISMYZOK-NYYWCZLTSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene?
The IUPAC name of (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene (CID 138741990) is (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene.
What is the SMILES notation for (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene?
The canonical SMILES for (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene is C/C=C(\CCCCC)CCOCC(F)(F)F.
What is the InChIKey of (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene?
The InChIKey is AATAVTUISMYZOK-NYYWCZLTSA-N. The full InChI is InChI=1S/C12H21F3O/c1-3-5-6-7-11(4-2)8-9-16-10-12(13,14)15/h4H,3,5-10H2,1-2H3/b11-4+.
What are the key properties of (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene?
(E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene has a molecular weight of 238.29 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(2,2,2-trifluoroethoxy)ethyl]oct-2-ene is sourced from PubChem (CID 138741990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).