About 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide
2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide (PubChem CID 138742717) has the molecular formula C18H12F3N3O3S
and a molecular weight of 407.37 g/mol. Its IUPAC name is 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 138742717 |
| Molecular Formula | C18H12F3N3O3S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)c2ccccc2CN1c1cc(C(F)(F)F)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C18H12F3N3O3S/c19-18(20,21)15-10-16(23-17(22-15)27-13-7-2-1-3-8-13)24-11-12-6-4-5-9-14(12)28(24,25)26/h1-10H,11H2 |
| InChIKey | WEEHONPLPOANSI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide (CID 138742717) is 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide is O=S1(=O)c2ccccc2CN1c1cc(C(F)(F)F)nc(Oc2ccccc2)n1.
What is the InChIKey of 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide?
The InChIKey is WEEHONPLPOANSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3N3O3S/c19-18(20,21)15-10-16(23-17(22-15)27-13-7-2-1-3-8-13)24-11-12-6-4-5-9-14(12)28(24,25)26/h1-10H,11H2.
What are the key properties of 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide?
2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide has a molecular weight of 407.37 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-phenoxy-6-(trifluoromethyl)pyrimidin-4-yl]-3H-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 138742717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).