C20H17N3O5S — CID 138742719
5-benzyl-N-[(3S)-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 138742719) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 5-benzyl-N-[(3S)-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3S)-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 138742719 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 5-benzyl-N-[(3S)-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CS(=O)(=O)c2ccccc2NC1=O)c1cc(Cc2ccccc2)on1 |
| InChI | InChI=1S/C20H17N3O5S/c24-19(16-11-14(28-23-16)10-13-6-2-1-3-7-13)22-17-12-29(26,27)18-9-5-4-8-15(18)21-20(17)25/h1-9,11,17H,10,12H2,(H,21,25)(H,22,24)/t17-/m1/s1 |
| InChIKey | GCXSDJBPWVZLCU-QGZVFWFLSA-N |
| XLogP | 1.79 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |