About 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine
1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine (PubChem CID 138743089) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine |
| PubChem CID | 138743089 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine |
| SMILES | CC(C)(C)N1CCN(C2COCCOC2)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-13(2,3)15-6-4-14(5-7-15)12-10-16-8-9-17-11-12/h12H,4-11H2,1-3H3 |
| InChIKey | DNQPJSKAWMHRTG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine?
The IUPAC name of 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine (CID 138743089) is 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine.
What is the SMILES notation for 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine?
The canonical SMILES for 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine is CC(C)(C)N1CCN(C2COCCOC2)CC1.
What is the InChIKey of 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine?
The InChIKey is DNQPJSKAWMHRTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-13(2,3)15-6-4-14(5-7-15)12-10-16-8-9-17-11-12/h12H,4-11H2,1-3H3.
What are the key properties of 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine?
1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine has a molecular weight of 242.36 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(1,4-dioxepan-6-yl)piperazine is sourced from PubChem (CID 138743089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).