About 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide
2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide (PubChem CID 138743151) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide |
| PubChem CID | 138743151 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide |
| SMILES | CNC(=O)c1ccc(C(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(2,3)13-10(15)8-6-5-7(16-8)9(14)12-4/h5-6H,1-4H3,(H,12,14)(H,13,15) |
| InChIKey | WGQTZKIFADUTFD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide?
The IUPAC name of 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide (CID 138743151) is 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide.
What is the SMILES notation for 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide?
The canonical SMILES for 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide is CNC(=O)c1ccc(C(=O)NC(C)(C)C)s1.
What is the InChIKey of 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide?
The InChIKey is WGQTZKIFADUTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-11(2,3)13-10(15)8-6-5-7(16-8)9(14)12-4/h5-6H,1-4H3,(H,12,14)(H,13,15).
What are the key properties of 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide?
2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide has a molecular weight of 240.33 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-tert-butyl-5-N-methylthiophene-2,5-dicarboxamide is sourced from PubChem (CID 138743151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).