C18H30N2O — CID 138743398
2,2-ditert-butyl-4-(pyridin-4-ylmethyl)morpholine (PubChem CID 138743398) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,2-ditert-butyl-4-(pyridin-4-ylmethyl)morpholine.
| Compound Name | 2,2-ditert-butyl-4-(pyridin-4-ylmethyl)morpholine |
|---|---|
| PubChem CID | 138743398 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,2-ditert-butyl-4-(pyridin-4-ylmethyl)morpholine |
| SMILES | CC(C)(C)C1(C(C)(C)C)CN(Cc2ccncc2)CCO1 |
| InChI | InChI=1S/C18H30N2O/c1-16(2,3)18(17(4,5)6)14-20(11-12-21-18)13-15-7-9-19-10-8-15/h7-10H,11-14H2,1-6H3 |
| InChIKey | PKIPWPDKTHSXRL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |