C21H28N2 — CID 138744192
1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-(6-hex-4-en-3-ylcyclohexa-1,3-dien-1-yl)imidazole (PubChem CID 138744192) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-(6-hex-4-en-3-ylcyclohexa-1,3-dien-1-yl)imidazole.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-(6-hex-4-en-3-ylcyclohexa-1,3-dien-1-yl)imidazole |
|---|---|
| PubChem CID | 138744192 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-(6-hex-4-en-3-ylcyclohexa-1,3-dien-1-yl)imidazole |
| SMILES | CC=CC(CC)C1CC=CC=C1c1nccn1C(/C=C\C)=C/C |
| InChI | InChI=1S/C21H28N2/c1-5-11-17(7-3)19-13-9-10-14-20(19)21-22-15-16-23(21)18(8-4)12-6-2/h5-6,8-12,14-17,19H,7,13H2,1-4H3/b11-5?,12-6-,18-8+ |
| InChIKey | COKHGTBNBDEBRK-XLHYAHRNSA-N |
| XLogP | 5.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|