About 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine
2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine (PubChem CID 138744632) has the molecular formula C15H30FN3
and a molecular weight of 271.42 g/mol. Its IUPAC name is 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine.
Molecular Properties
| Compound Name | 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine |
| PubChem CID | 138744632 |
| Molecular Formula | C15H30FN3 |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine |
| SMILES | CCC1CN(CC2CN(C)CCC2(C)F)CCN1C |
| InChI | InChI=1S/C15H30FN3/c1-5-14-12-19(9-8-18(14)4)11-13-10-17(3)7-6-15(13,2)16/h13-14H,5-12H2,1-4H3 |
| InChIKey | NIMXECBRTYXQDL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine?
The IUPAC name of 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine (CID 138744632) is 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine.
What is the SMILES notation for 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine?
The canonical SMILES for 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine is CCC1CN(CC2CN(C)CCC2(C)F)CCN1C.
What is the InChIKey of 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine?
The InChIKey is NIMXECBRTYXQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30FN3/c1-5-14-12-19(9-8-18(14)4)11-13-10-17(3)7-6-15(13,2)16/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine?
2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine has a molecular weight of 271.42 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[(4-fluoro-1,4-dimethylpiperidin-3-yl)methyl]-1-methylpiperazine is sourced from PubChem (CID 138744632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).