About 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione
7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione (PubChem CID 138744713) has the molecular formula C8H11N5S
and a molecular weight of 209.28 g/mol. Its IUPAC name is 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione.
Molecular Properties
| Compound Name | 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione |
| PubChem CID | 138744713 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione |
| SMILES | CC(C)(C)n1cnc2c(=S)nn[nH]c21 |
| InChI | InChI=1S/C8H11N5S/c1-8(2,3)13-4-9-5-6(13)10-12-11-7(5)14/h4H,1-3H3,(H,10,11,14) |
| InChIKey | GGCOPAPJWRAGFU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione?
The IUPAC name of 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione (CID 138744713) is 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione.
What is the SMILES notation for 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione?
The canonical SMILES for 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione is CC(C)(C)n1cnc2c(=S)nn[nH]c21.
What is the InChIKey of 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione?
The InChIKey is GGCOPAPJWRAGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5S/c1-8(2,3)13-4-9-5-6(13)10-12-11-7(5)14/h4H,1-3H3,(H,10,11,14).
What are the key properties of 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione?
7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione has a molecular weight of 209.28 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-1H-imidazo[4,5-d]triazine-4-thione is sourced from PubChem (CID 138744713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).