About 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine
5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 138744768) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
| PubChem CID | 138744768 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | CSc1nc2c(o1)CN(C)CC2 |
| InChI | InChI=1S/C8H12N2OS/c1-10-4-3-6-7(5-10)11-8(9-6)12-2/h3-5H2,1-2H3 |
| InChIKey | HNCZVCSZYVTTPH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine?
The IUPAC name of 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine (CID 138744768) is 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine.
What is the SMILES notation for 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine?
The canonical SMILES for 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine is CSc1nc2c(o1)CN(C)CC2.
What is the InChIKey of 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine?
The InChIKey is HNCZVCSZYVTTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-10-4-3-6-7(5-10)11-8(9-6)12-2/h3-5H2,1-2H3.
What are the key properties of 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine?
5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine has a molecular weight of 184.26 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-methylsulfanyl-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine is sourced from PubChem (CID 138744768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).