C35H56N8O6 — CID 138744920
tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 138744920) has the molecular formula C35H56N8O6 and a molecular weight of 684.88 g/mol. Its IUPAC name is tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 138744920 |
| Molecular Formula | C35H56N8O6 |
| Molecular Weight | 684.88 g/mol |
| Exact Mass | 684.43 |
| IUPAC Name | tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(Cc2cccc(-c3cnncn3)n2)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C35H56N8O6/c1-33(2,3)47-30(44)23-41-15-13-40(22-27-11-10-12-28(39-27)29-21-37-38-26-36-29)14-16-42(24-31(45)48-34(4,5)6)18-20-43(19-17-41)25-32(46)49-35(7,8)9/h10-12,21,26H,13-20,22-25H2,1-9H3 |
| InChIKey | FOIZIJVQNILYNV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 143.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|