C23H32N8O6 — CID 138745189
2-[4,7-bis(carboxymethyl)-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 138745189) has the molecular formula C23H32N8O6 and a molecular weight of 516.56 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 138745189 |
| Molecular Formula | C23H32N8O6 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[[6-(1,2,4-triazin-5-yl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2cccc(-c3cnncn3)n2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C23H32N8O6/c32-21(33)14-29-6-4-28(13-18-2-1-3-19(27-18)20-12-25-26-17-24-20)5-7-30(15-22(34)35)9-11-31(10-8-29)16-23(36)37/h1-3,12,17H,4-11,13-16H2,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | OPNCBXGDKCCDIJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |