C54H34Cl2N4 — CID 138745978
4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,6,11,12-tetrahydroindolo[3,2-b]carbazole (PubChem CID 138745978) has the molecular formula C54H34Cl2N4 and a molecular weight of 809.80 g/mol. Its IUPAC name is 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,6,11,12-tetrahydroindolo[3,2-b]carbazole.
| Compound Name | 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,6,11,12-tetrahydroindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 138745978 |
| Molecular Formula | C54H34Cl2N4 |
| Molecular Weight | 809.80 g/mol |
| Exact Mass | 808.22 |
| IUPAC Name | 4-[2-chloro-5-(1,10-phenanthrolin-3-yl)phenyl]-10-(2-chlorophenyl)-6,12-diphenyl-5,6,11,12-tetrahydroindolo[3,2-b]carbazole |
| SMILES | Clc1ccccc1-c1cccc2c3c([nH]c12)C(c1ccccc1)c1c([nH]c2c(-c4cc(-c5cnc6c(ccc7cccnc76)c5)ccc4Cl)cccc12)C3c1ccccc1 |
| InChI | InChI=1S/C54H34Cl2N4/c55-43-22-8-7-17-37(43)38-18-9-20-40-47-45(31-12-3-1-4-13-31)54-48(46(53(47)59-51(38)40)32-14-5-2-6-15-32)41-21-10-19-39(52(41)60-54)42-29-34(25-26-44(42)56)36-28-35-24-23-33-16-11-27-57-49(33)50(35)58-30-36/h1-30,45-46,59-60H |
| InChIKey | KQALHHSZEXOTQK-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.80 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|