C13H11F13OS — CID 138747037
3-methyl-5-(1,1,2,2,3,3,5,5,6,6,8,8,8-tridecafluorooctyl)thiolan-2-one (PubChem CID 138747037) has the molecular formula C13H11F13OS and a molecular weight of 462.27 g/mol. Its IUPAC name is 3-methyl-5-(1,1,2,2,3,3,5,5,6,6,8,8,8-tridecafluorooctyl)thiolan-2-one.
| Compound Name | 3-methyl-5-(1,1,2,2,3,3,5,5,6,6,8,8,8-tridecafluorooctyl)thiolan-2-one |
|---|---|
| PubChem CID | 138747037 |
| Molecular Formula | C13H11F13OS |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 3-methyl-5-(1,1,2,2,3,3,5,5,6,6,8,8,8-tridecafluorooctyl)thiolan-2-one |
| SMILES | CC1CC(C(F)(F)C(F)(F)C(F)(F)CC(F)(F)C(F)(F)CC(F)(F)F)SC1=O |
| InChI | InChI=1S/C13H11F13OS/c1-5-2-6(28-7(5)27)12(23,24)13(25,26)10(18,19)3-8(14,15)9(16,17)4-11(20,21)22/h5-6H,2-4H2,1H3 |
| InChIKey | MEPWPEMPAGIGKO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|