C29H42O7S — CID 138747149
[(1R,2R,6R,7R,8S,9R,14R)-9-methoxy-2,4,4,7,14-pentamethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 138747149) has the molecular formula C29H42O7S and a molecular weight of 534.72 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8S,9R,14R)-9-methoxy-2,4,4,7,14-pentamethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1R,2R,6R,7R,8S,9R,14R)-9-methoxy-2,4,4,7,14-pentamethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 138747149 |
| Molecular Formula | C29H42O7S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [(1R,2R,6R,7R,8S,9R,14R)-9-methoxy-2,4,4,7,14-pentamethyl-3-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | CO[C@@H]1CC[C@@]23CC[C@@H](C)[C@@](C)([C@H](OC(=O)COS(=O)(=O)c4ccc(C)cc4)CC(C)(C)C(=O)[C@@H]2C)[C@@H]13 |
| InChI | InChI=1S/C29H42O7S/c1-18-8-10-21(11-9-18)37(32,33)35-17-24(30)36-23-16-27(4,5)26(31)20(3)29-14-12-19(2)28(23,6)25(29)22(34-7)13-15-29/h8-11,19-20,22-23,25H,12-17H2,1-7H3/t19-,20+,22-,23-,25-,28+,29+/m1/s1 |
| InChIKey | OTIFKPXDCDLMDE-PQLJKXPUSA-N |
| XLogP | 5.09 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|