C25H28ClN5O4S2 — CID 138747333
[(1R,3S)-3-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 138747333) has the molecular formula C25H28ClN5O4S2 and a molecular weight of 562.12 g/mol. Its IUPAC name is [(1R,3S)-3-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,3S)-3-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 138747333 |
| Molecular Formula | C25H28ClN5O4S2 |
| Molecular Weight | 562.12 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | [(1R,3S)-3-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@H]2CC[C@@H](COS(N)(=O)=O)C2)cc1[C@@H]1NCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H28ClN5O4S2/c1-14-19(23-20-9-17(26)4-3-16(20)6-7-29-23)10-22(36-14)24(32)21-11-28-13-30-25(21)31-18-5-2-15(8-18)12-35-37(27,33)34/h3-4,9-11,13,15,18,23,29H,2,5-8,12H2,1H3,(H2,27,33,34)(H,28,30,31)/t15-,18+,23+/m1/s1 |
| InChIKey | WAJDFMAGYBSNTB-TWWFPWMWSA-N |
| XLogP | 3.77 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.12 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |