About N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine
N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine (PubChem CID 138747410) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine.
Molecular Properties
| Compound Name | N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine |
| PubChem CID | 138747410 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine |
| SMILES | C=NC1=C(/C=C\C)CCN1 |
| InChI | InChI=1S/C8H12N2/c1-3-4-7-5-6-10-8(7)9-2/h3-4,10H,2,5-6H2,1H3/b4-3- |
| InChIKey | LSNDAZGMPVXARB-ARJAWSKDSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine?
The IUPAC name of N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine (CID 138747410) is N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine.
What is the SMILES notation for N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine?
The canonical SMILES for N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine is C=NC1=C(/C=C\C)CCN1.
What is the InChIKey of N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine?
The InChIKey is LSNDAZGMPVXARB-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-4-7-5-6-10-8(7)9-2/h3-4,10H,2,5-6H2,1H3/b4-3-.
What are the key properties of N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine?
N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine has a molecular weight of 136.20 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrrol-5-yl]methanimine is sourced from PubChem (CID 138747410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).