About 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole
5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole (PubChem CID 138747681) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole.
Molecular Properties
| Compound Name | 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole |
| PubChem CID | 138747681 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole |
| SMILES | C=CC1=CCC(C(CC(C)C)CC(C)(C)C)=N1 |
| InChI | InChI=1S/C16H27N/c1-7-14-8-9-15(17-14)13(10-12(2)3)11-16(4,5)6/h7-8,12-13H,1,9-11H2,2-6H3 |
| InChIKey | REAOEJWNFVOFFG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole?
The IUPAC name of 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole (CID 138747681) is 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole.
What is the SMILES notation for 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole?
The canonical SMILES for 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole is C=CC1=CCC(C(CC(C)C)CC(C)(C)C)=N1.
What is the InChIKey of 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole?
The InChIKey is REAOEJWNFVOFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-7-14-8-9-15(17-14)13(10-12(2)3)11-16(4,5)6/h7-8,12-13H,1,9-11H2,2-6H3.
What are the key properties of 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole?
5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole has a molecular weight of 233.40 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2-(2,2,6-trimethylheptan-4-yl)-3H-pyrrole is sourced from PubChem (CID 138747681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).