C23H38N6O5S — CID 138747747
(2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-1-(2,3-dimethylbut-3-en-2-yloxycarbonylamino)-3-methylbutyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid (PubChem CID 138747747) has the molecular formula C23H38N6O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-1-(2,3-dimethylbut-3-en-2-yloxycarbonylamino)-3-methylbutyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-1-(2,3-dimethylbut-3-en-2-yloxycarbonylamino)-3-methylbutyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 138747747 |
| Molecular Formula | C23H38N6O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-1-(2,3-dimethylbut-3-en-2-yloxycarbonylamino)-3-methylbutyl]-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid |
| SMILES | C=C(C)C(C)(C)OC(=O)N[C@@H](CC(C)C)c1nc(C)c(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)s1 |
| InChI | InChI=1S/C23H38N6O5S/c1-12(2)11-16(29-22(33)34-23(6,7)13(3)4)19-27-14(5)17(35-19)18(30)28-15(20(31)32)9-8-10-26-21(24)25/h12,15-16H,3,8-11H2,1-2,4-7H3,(H,28,30)(H,29,33)(H,31,32)(H4,24,25,26)/t15-,16-/m0/s1 |
| InChIKey | LHNUXBUWHADREH-HOTGVXAUSA-N |
| XLogP | 2.86 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|