About (Z)-5,5-difluoro-2-methylnon-7-en-4-ol
(Z)-5,5-difluoro-2-methylnon-7-en-4-ol (PubChem CID 138747780) has the molecular formula C10H18F2O
and a molecular weight of 192.25 g/mol. Its IUPAC name is (Z)-5,5-difluoro-2-methylnon-7-en-4-ol.
Molecular Properties
| Compound Name | (Z)-5,5-difluoro-2-methylnon-7-en-4-ol |
| PubChem CID | 138747780 |
| Molecular Formula | C10H18F2O |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (Z)-5,5-difluoro-2-methylnon-7-en-4-ol |
| SMILES | C/C=C\CC(F)(F)C(O)CC(C)C |
| InChI | InChI=1S/C10H18F2O/c1-4-5-6-10(11,12)9(13)7-8(2)3/h4-5,8-9,13H,6-7H2,1-3H3/b5-4- |
| InChIKey | JWKDKCMZJDIRPE-PLNGDYQASA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,5-difluoro-2-methylnon-7-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5-difluoro-2-methylnon-7-en-4-ol?
The IUPAC name of (Z)-5,5-difluoro-2-methylnon-7-en-4-ol (CID 138747780) is (Z)-5,5-difluoro-2-methylnon-7-en-4-ol.
What is the SMILES notation for (Z)-5,5-difluoro-2-methylnon-7-en-4-ol?
The canonical SMILES for (Z)-5,5-difluoro-2-methylnon-7-en-4-ol is C/C=C\CC(F)(F)C(O)CC(C)C.
What is the InChIKey of (Z)-5,5-difluoro-2-methylnon-7-en-4-ol?
The InChIKey is JWKDKCMZJDIRPE-PLNGDYQASA-N. The full InChI is InChI=1S/C10H18F2O/c1-4-5-6-10(11,12)9(13)7-8(2)3/h4-5,8-9,13H,6-7H2,1-3H3/b5-4-.
What are the key properties of (Z)-5,5-difluoro-2-methylnon-7-en-4-ol?
(Z)-5,5-difluoro-2-methylnon-7-en-4-ol has a molecular weight of 192.25 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5-difluoro-2-methylnon-7-en-4-ol is sourced from PubChem (CID 138747780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).